C21H19N3O4S — CID 168623332
ethyl 2-[2-[2-[[4-(4-formyl-3-hydroxyphenyl)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168623332) has the molecular formula C21H19N3O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[4-(4-formyl-3-hydroxyphenyl)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[4-(4-formyl-3-hydroxyphenyl)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168623332 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | ethyl 2-[2-[2-[[4-(4-formyl-3-hydroxyphenyl)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc(-c3ccc(C=O)c(O)c3)cc2)n1 |
| InChI | InChI=1S/C21H19N3O4S/c1-2-28-20(27)10-18-13-29-21(23-18)24-22-11-14-3-5-15(6-4-14)16-7-8-17(12-25)19(26)9-16/h3-9,11-13,26H,2,10H2,1H3,(H,23,24) |
| InChIKey | HNVULEZDFNWYBO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|