C22H22IN3O4S — CID 168623404
ethyl 2-[2-[2-[[3-[(4-iodophenoxy)methyl]-4-methoxyphenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168623404) has the molecular formula C22H22IN3O4S and a molecular weight of 551.41 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[3-[(4-iodophenoxy)methyl]-4-methoxyphenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[3-[(4-iodophenoxy)methyl]-4-methoxyphenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168623404 |
| Molecular Formula | C22H22IN3O4S |
| Molecular Weight | 551.41 g/mol |
| Exact Mass | 551.04 |
| IUPAC Name | ethyl 2-[2-[2-[[3-[(4-iodophenoxy)methyl]-4-methoxyphenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc(OC)c(COc3ccc(I)cc3)c2)n1 |
| InChI | InChI=1S/C22H22IN3O4S/c1-3-29-21(27)11-18-14-31-22(25-18)26-24-12-15-4-9-20(28-2)16(10-15)13-30-19-7-5-17(23)6-8-19/h4-10,12,14H,3,11,13H2,1-2H3,(H,25,26) |
| InChIKey | RFMQABFKYNTOCW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|