C20H26N4O2S — CID 168623959
ethyl 2-[2-[2-[(2-methyl-4-piperidin-1-ylphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168623959) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(2-methyl-4-piperidin-1-ylphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[(2-methyl-4-piperidin-1-ylphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168623959 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | ethyl 2-[2-[2-[(2-methyl-4-piperidin-1-ylphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc(N3CCCCC3)cc2C)n1 |
| InChI | InChI=1S/C20H26N4O2S/c1-3-26-19(25)12-17-14-27-20(22-17)23-21-13-16-7-8-18(11-15(16)2)24-9-5-4-6-10-24/h7-8,11,13-14H,3-6,9-10,12H2,1-2H3,(H,22,23) |
| InChIKey | FCHLDUQVVJTACG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|