C21H19ClN4O5S — CID 168624404
methyl 2-[2-chloro-4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenoxy]pyridine-4-carboxylate (PubChem CID 168624404) has the molecular formula C21H19ClN4O5S and a molecular weight of 474.93 g/mol. Its IUPAC name is methyl 2-[2-chloro-4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenoxy]pyridine-4-carboxylate.
| Compound Name | methyl 2-[2-chloro-4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenoxy]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 168624404 |
| Molecular Formula | C21H19ClN4O5S |
| Molecular Weight | 474.93 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | methyl 2-[2-chloro-4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenoxy]pyridine-4-carboxylate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc(Oc3cc(C(=O)OC)ccn3)c(Cl)c2)n1 |
| InChI | InChI=1S/C21H19ClN4O5S/c1-3-30-19(27)10-15-12-32-21(25-15)26-24-11-13-4-5-17(16(22)8-13)31-18-9-14(6-7-23-18)20(28)29-2/h4-9,11-12H,3,10H2,1-2H3,(H,25,26) |
| InChIKey | HXMMWKLOUKAZHF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 112.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.93 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|