C19H24BrN3O4S — CID 168624566
ethyl 2-[2-[2-[(3-bromo-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168624566) has the molecular formula C19H24BrN3O4S and a molecular weight of 470.39 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(3-bromo-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[(3-bromo-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168624566 |
| Molecular Formula | C19H24BrN3O4S |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | ethyl 2-[2-[2-[(3-bromo-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2cc(Br)c(OC(C)C)c(OCC)c2)n1 |
| InChI | InChI=1S/C19H24BrN3O4S/c1-5-25-16-8-13(7-15(20)18(16)27-12(3)4)10-21-23-19-22-14(11-28-19)9-17(24)26-6-2/h7-8,10-12H,5-6,9H2,1-4H3,(H,22,23) |
| InChIKey | OIIZGNDNLIMMPV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|