C15H12F5N3O3S — CID 168624989
ethyl 2-[2-[2-[[2,3-difluoro-4-(trifluoromethoxy)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168624989) has the molecular formula C15H12F5N3O3S and a molecular weight of 409.34 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[2,3-difluoro-4-(trifluoromethoxy)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[2,3-difluoro-4-(trifluoromethoxy)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168624989 |
| Molecular Formula | C15H12F5N3O3S |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | ethyl 2-[2-[2-[[2,3-difluoro-4-(trifluoromethoxy)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc(OC(F)(F)F)c(F)c2F)n1 |
| InChI | InChI=1S/C15H12F5N3O3S/c1-2-25-11(24)5-9-7-27-14(22-9)23-21-6-8-3-4-10(13(17)12(8)16)26-15(18,19)20/h3-4,6-7H,2,5H2,1H3,(H,22,23) |
| InChIKey | WLTZRGWFLBRADK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|