C25H24N4O5S — CID 168625091
ethyl 2-[2-[2-[[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168625091) has the molecular formula C25H24N4O5S and a molecular weight of 492.56 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168625091 |
| Molecular Formula | C25H24N4O5S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | ethyl 2-[2-[2-[[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc(OCCCN3C(=O)c4ccccc4C3=O)cc2)n1 |
| InChI | InChI=1S/C25H24N4O5S/c1-2-33-22(30)14-18-16-35-25(27-18)28-26-15-17-8-10-19(11-9-17)34-13-5-12-29-23(31)20-6-3-4-7-21(20)24(29)32/h3-4,6-11,15-16H,2,5,12-14H2,1H3,(H,27,28) |
| InChIKey | GGRACAVYOKQJDS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|