C17H15F6N3O4S — CID 168625340
ethyl 2-[2-[2-[[4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168625340) has the molecular formula C17H15F6N3O4S and a molecular weight of 471.38 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168625340 |
| Molecular Formula | C17H15F6N3O4S |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | ethyl 2-[2-[2-[[4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc(OC(F)(F)C(F)OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C17H15F6N3O4S/c1-2-28-13(27)7-11-9-31-15(25-11)26-24-8-10-3-5-12(6-4-10)29-16(19,20)14(18)30-17(21,22)23/h3-6,8-9,14H,2,7H2,1H3,(H,25,26) |
| InChIKey | QECUOFVPMSPRAJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|