C17H20N6OS — CID 168626634
2-N-[[4-propan-2-yloxy-3-(pyrazol-1-ylmethyl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168626634) has the molecular formula C17H20N6OS and a molecular weight of 356.46 g/mol. Its IUPAC name is 2-N-[[4-propan-2-yloxy-3-(pyrazol-1-ylmethyl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[4-propan-2-yloxy-3-(pyrazol-1-ylmethyl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168626634 |
| Molecular Formula | C17H20N6OS |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-N-[[4-propan-2-yloxy-3-(pyrazol-1-ylmethyl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | CC(C)Oc1ccc(C=NNc2nc(N)cs2)cc1Cn1cccn1 |
| InChI | InChI=1S/C17H20N6OS/c1-12(2)24-15-5-4-13(8-14(15)10-23-7-3-6-20-23)9-19-22-17-21-16(18)11-25-17/h3-9,11-12H,10,18H2,1-2H3,(H,21,22) |
| InChIKey | XVWUMSZRJIQKBN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|