C16H18N6OS — CID 168627389
2-N-[[4-ethoxy-3-(pyrazol-1-ylmethyl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168627389) has the molecular formula C16H18N6OS and a molecular weight of 342.43 g/mol. Its IUPAC name is 2-N-[[4-ethoxy-3-(pyrazol-1-ylmethyl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[4-ethoxy-3-(pyrazol-1-ylmethyl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168627389 |
| Molecular Formula | C16H18N6OS |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-N-[[4-ethoxy-3-(pyrazol-1-ylmethyl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | CCOc1ccc(C=NNc2nc(N)cs2)cc1Cn1cccn1 |
| InChI | InChI=1S/C16H18N6OS/c1-2-23-14-5-4-12(8-13(14)10-22-7-3-6-19-22)9-18-21-16-20-15(17)11-24-16/h3-9,11H,2,10,17H2,1H3,(H,20,21) |
| InChIKey | GBYQDOWNDMVNHP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|