C19H23N3O5S2 — CID 16862939
1-(4-methoxyphenyl)sulfonyl-N-[3-(methylcarbamoyl)thiophen-2-yl]piperidine-3-carboxamide (PubChem CID 16862939) has the molecular formula C19H23N3O5S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)sulfonyl-N-[3-(methylcarbamoyl)thiophen-2-yl]piperidine-3-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)sulfonyl-N-[3-(methylcarbamoyl)thiophen-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 16862939 |
| Molecular Formula | C19H23N3O5S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 1-(4-methoxyphenyl)sulfonyl-N-[3-(methylcarbamoyl)thiophen-2-yl]piperidine-3-carboxamide |
| SMILES | CNC(=O)c1ccsc1NC(=O)C1CCCN(S(=O)(=O)c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C19H23N3O5S2/c1-20-18(24)16-9-11-28-19(16)21-17(23)13-4-3-10-22(12-13)29(25,26)15-7-5-14(27-2)6-8-15/h5-9,11,13H,3-4,10,12H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | SUDOLLIHJPSWSW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |