C14H14FNO8S — CID 168632765
3-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-4-fluorobenzenesulfonic acid (PubChem CID 168632765) has the molecular formula C14H14FNO8S and a molecular weight of 375.33 g/mol. Its IUPAC name is 3-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-4-fluorobenzenesulfonic acid.
| Compound Name | 3-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-4-fluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 168632765 |
| Molecular Formula | C14H14FNO8S |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 3-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-4-fluorobenzenesulfonic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(S(=O)(=O)O)ccc2F)COC1 |
| InChI | InChI=1S/C14H14FNO8S/c1-22-13(17)9-6-24-7-16(12(9)14(18)23-2)11-5-8(25(19,20)21)3-4-10(11)15/h3-5H,6-7H2,1-2H3,(H,19,20,21) |
| InChIKey | IVTQWTAZRNEPPI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|