C18H19NO8 — CID 168634525
dimethyl 3-[2-(2-oxopropoxycarbonyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168634525) has the molecular formula C18H19NO8 and a molecular weight of 377.35 g/mol. Its IUPAC name is dimethyl 3-[2-(2-oxopropoxycarbonyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[2-(2-oxopropoxycarbonyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168634525 |
| Molecular Formula | C18H19NO8 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | dimethyl 3-[2-(2-oxopropoxycarbonyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccccc2C(=O)OCC(C)=O)COC1 |
| InChI | InChI=1S/C18H19NO8/c1-11(20)8-27-17(22)12-6-4-5-7-14(12)19-10-26-9-13(16(21)24-2)15(19)18(23)25-3/h4-7H,8-10H2,1-3H3 |
| InChIKey | PJZKMBHFYFFUPN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|