C20H16Cl2N2O8S — CID 168634703
8-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-3,6-dichloro-9H-carbazole-1-sulfonic acid (PubChem CID 168634703) has the molecular formula C20H16Cl2N2O8S and a molecular weight of 515.33 g/mol. Its IUPAC name is 8-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-3,6-dichloro-9H-carbazole-1-sulfonic acid.
| Compound Name | 8-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-3,6-dichloro-9H-carbazole-1-sulfonic acid |
|---|---|
| PubChem CID | 168634703 |
| Molecular Formula | C20H16Cl2N2O8S |
| Molecular Weight | 515.33 g/mol |
| Exact Mass | 514.00 |
| IUPAC Name | 8-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-3,6-dichloro-9H-carbazole-1-sulfonic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(Cl)cc3c2[nH]c2c(S(=O)(=O)O)cc(Cl)cc23)COC1 |
| InChI | InChI=1S/C20H16Cl2N2O8S/c1-30-19(25)13-7-32-8-24(18(13)20(26)31-2)14-5-9(21)3-11-12-4-10(22)6-15(33(27,28)29)17(12)23-16(11)14/h3-6,23H,7-8H2,1-2H3,(H,27,28,29) |
| InChIKey | JMIPNKRLMBZPHD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 135.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|