C16H14F5NO5 — CID 168635304
dimethyl 3-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168635304) has the molecular formula C16H14F5NO5 and a molecular weight of 395.28 g/mol. Its IUPAC name is dimethyl 3-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168635304 |
| Molecular Formula | C16H14F5NO5 |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | dimethyl 3-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccccc2C(F)(F)C(F)(F)F)COC1 |
| InChI | InChI=1S/C16H14F5NO5/c1-25-13(23)9-7-27-8-22(12(9)14(24)26-2)11-6-4-3-5-10(11)15(17,18)16(19,20)21/h3-6H,7-8H2,1-2H3 |
| InChIKey | YROOUBVOCQKFBK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|