C20H23ClN2O8 — CID 168635996
dimethyl 3-[3-(2-acetamido-3-methoxy-3-oxopropyl)-4-chlorophenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168635996) has the molecular formula C20H23ClN2O8 and a molecular weight of 454.86 g/mol. Its IUPAC name is dimethyl 3-[3-(2-acetamido-3-methoxy-3-oxopropyl)-4-chlorophenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[3-(2-acetamido-3-methoxy-3-oxopropyl)-4-chlorophenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168635996 |
| Molecular Formula | C20H23ClN2O8 |
| Molecular Weight | 454.86 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | dimethyl 3-[3-(2-acetamido-3-methoxy-3-oxopropyl)-4-chlorophenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(Cl)c(CC(NC(C)=O)C(=O)OC)c2)COC1 |
| InChI | InChI=1S/C20H23ClN2O8/c1-11(24)22-16(19(26)29-3)8-12-7-13(5-6-15(12)21)23-10-31-9-14(18(25)28-2)17(23)20(27)30-4/h5-7,16H,8-10H2,1-4H3,(H,22,24) |
| InChIKey | JEDMLQBIUWERBC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.86 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|