C15H23ClN2O2 — CID 168637118
3-[(3-chloro-2-hydroxypropyl)amino]-4-methyl-N-(2-methylpropyl)benzamide (PubChem CID 168637118) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is 3-[(3-chloro-2-hydroxypropyl)amino]-4-methyl-N-(2-methylpropyl)benzamide.
| Compound Name | 3-[(3-chloro-2-hydroxypropyl)amino]-4-methyl-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 168637118 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-[(3-chloro-2-hydroxypropyl)amino]-4-methyl-N-(2-methylpropyl)benzamide |
| SMILES | Cc1ccc(C(=O)NCC(C)C)cc1NCC(O)CCl |
| InChI | InChI=1S/C15H23ClN2O2/c1-10(2)8-18-15(20)12-5-4-11(3)14(6-12)17-9-13(19)7-16/h4-6,10,13,17,19H,7-9H2,1-3H3,(H,18,20) |
| InChIKey | CJJKTRLKWHMGQY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|