C15H18ClNO2 — CID 168637521
1-chloro-3-(6,7,8,9-tetrahydrodibenzofuran-4-ylamino)propan-2-ol (PubChem CID 168637521) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 1-chloro-3-(6,7,8,9-tetrahydrodibenzofuran-4-ylamino)propan-2-ol.
| Compound Name | 1-chloro-3-(6,7,8,9-tetrahydrodibenzofuran-4-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 168637521 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-chloro-3-(6,7,8,9-tetrahydrodibenzofuran-4-ylamino)propan-2-ol |
| SMILES | OC(CCl)CNc1cccc2c3c(oc12)CCCC3 |
| InChI | InChI=1S/C15H18ClNO2/c16-8-10(18)9-17-13-6-3-5-12-11-4-1-2-7-14(11)19-15(12)13/h3,5-6,10,17-18H,1-2,4,7-9H2 |
| InChIKey | FPHVALGKLNOPKH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|