C17H21ClN2O3S — CID 168638523
4-[(3-chloro-2-hydroxypropyl)amino]-N-(2,5-dimethylphenyl)benzenesulfonamide (PubChem CID 168638523) has the molecular formula C17H21ClN2O3S and a molecular weight of 368.89 g/mol. Its IUPAC name is 4-[(3-chloro-2-hydroxypropyl)amino]-N-(2,5-dimethylphenyl)benzenesulfonamide.
| Compound Name | 4-[(3-chloro-2-hydroxypropyl)amino]-N-(2,5-dimethylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 168638523 |
| Molecular Formula | C17H21ClN2O3S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 4-[(3-chloro-2-hydroxypropyl)amino]-N-(2,5-dimethylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(C)c(NS(=O)(=O)c2ccc(NCC(O)CCl)cc2)c1 |
| InChI | InChI=1S/C17H21ClN2O3S/c1-12-3-4-13(2)17(9-12)20-24(22,23)16-7-5-14(6-8-16)19-11-15(21)10-18/h3-9,15,19-21H,10-11H2,1-2H3 |
| InChIKey | GKAWEQUGEBABCO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|