C13H16ClN3O2 — CID 168638572
1-chloro-3-[3-(5-ethyl-1,3,4-oxadiazol-2-yl)anilino]propan-2-ol (PubChem CID 168638572) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 1-chloro-3-[3-(5-ethyl-1,3,4-oxadiazol-2-yl)anilino]propan-2-ol.
| Compound Name | 1-chloro-3-[3-(5-ethyl-1,3,4-oxadiazol-2-yl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 168638572 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 1-chloro-3-[3-(5-ethyl-1,3,4-oxadiazol-2-yl)anilino]propan-2-ol |
| SMILES | CCc1nnc(-c2cccc(NCC(O)CCl)c2)o1 |
| InChI | InChI=1S/C13H16ClN3O2/c1-2-12-16-17-13(19-12)9-4-3-5-10(6-9)15-8-11(18)7-14/h3-6,11,15,18H,2,7-8H2,1H3 |
| InChIKey | YVLUMDQBYCQMKS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|