C15H20N2O4 — CID 16863923
4-(2,5-dimethoxybenzoyl)-3,3-dimethylpiperazin-2-one (PubChem CID 16863923) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 4-(2,5-dimethoxybenzoyl)-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-(2,5-dimethoxybenzoyl)-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 16863923 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 4-(2,5-dimethoxybenzoyl)-3,3-dimethylpiperazin-2-one |
| SMILES | COc1ccc(OC)c(C(=O)N2CCNC(=O)C2(C)C)c1 |
| InChI | InChI=1S/C15H20N2O4/c1-15(2)14(19)16-7-8-17(15)13(18)11-9-10(20-3)5-6-12(11)21-4/h5-6,9H,7-8H2,1-4H3,(H,16,19) |
| InChIKey | TWMVJDRJRXVUJD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |