C17H21ClN2O3 — CID 168639283
2-[4-[(3-chloro-2-hydroxypropyl)amino]phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 168639283) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is 2-[4-[(3-chloro-2-hydroxypropyl)amino]phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 2-[4-[(3-chloro-2-hydroxypropyl)amino]phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 168639283 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-[4-[(3-chloro-2-hydroxypropyl)amino]phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1C2CCCCC2C(=O)N1c1ccc(NCC(O)CCl)cc1 |
| InChI | InChI=1S/C17H21ClN2O3/c18-9-13(21)10-19-11-5-7-12(8-6-11)20-16(22)14-3-1-2-4-15(14)17(20)23/h5-8,13-15,19,21H,1-4,9-10H2 |
| InChIKey | SRHVHBGXIBPVFX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|