C15H18ClN3O — CID 168639378
1-chloro-3-[4-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)anilino]propan-2-ol (PubChem CID 168639378) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is 1-chloro-3-[4-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)anilino]propan-2-ol.
| Compound Name | 1-chloro-3-[4-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 168639378 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-chloro-3-[4-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)anilino]propan-2-ol |
| SMILES | OC(CCl)CNc1ccc(-c2cnc3n2CCC3)cc1 |
| InChI | InChI=1S/C15H18ClN3O/c16-8-13(20)9-17-12-5-3-11(4-6-12)14-10-18-15-2-1-7-19(14)15/h3-6,10,13,17,20H,1-2,7-9H2 |
| InChIKey | DQXCEPJXCYRBTG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|