C22H14N2O4 — CID 16863949
4-(3-oxobenzo[f]chromene-2-carbonyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 16863949) has the molecular formula C22H14N2O4 and a molecular weight of 370.36 g/mol. Its IUPAC name is 4-(3-oxobenzo[f]chromene-2-carbonyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-(3-oxobenzo[f]chromene-2-carbonyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 16863949 |
| Molecular Formula | C22H14N2O4 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 4-(3-oxobenzo[f]chromene-2-carbonyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C(=O)c2cc3c(ccc4ccccc43)oc2=O)c2ccccc2N1 |
| InChI | InChI=1S/C22H14N2O4/c25-20-12-24(18-8-4-3-7-17(18)23-20)21(26)16-11-15-14-6-2-1-5-13(14)9-10-19(15)28-22(16)27/h1-11H,12H2,(H,23,25) |
| InChIKey | LBJAGTVCXZCRQX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|