About 1-chloro-3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]propan-2-ol
1-chloro-3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]propan-2-ol (PubChem CID 168639561) has the molecular formula C20H21ClN2OS
and a molecular weight of 372.92 g/mol. Its IUPAC name is 1-chloro-3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]propan-2-ol.
Molecular Properties
| Compound Name | 1-chloro-3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]propan-2-ol |
| PubChem CID | 168639561 |
| Molecular Formula | C20H21ClN2OS |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 1-chloro-3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]propan-2-ol |
| SMILES | Cc1ccc(-c2csc(-c3cccc(NCC(O)CCl)c3)n2)c(C)c1 |
| InChI | InChI=1S/C20H21ClN2OS/c1-13-6-7-18(14(2)8-13)19-12-25-20(23-19)15-4-3-5-16(9-15)22-11-17(24)10-21/h3-9,12,17,22,24H,10-11H2,1-2H3 |
| InChIKey | RZONMLFIYOJUOT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]propan-2-ol?
The IUPAC name of 1-chloro-3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]propan-2-ol (CID 168639561) is 1-chloro-3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]propan-2-ol.
What is the SMILES notation for 1-chloro-3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]propan-2-ol?
The canonical SMILES for 1-chloro-3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]propan-2-ol is Cc1ccc(-c2csc(-c3cccc(NCC(O)CCl)c3)n2)c(C)c1.
What is the InChIKey of 1-chloro-3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]propan-2-ol?
The InChIKey is RZONMLFIYOJUOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21ClN2OS/c1-13-6-7-18(14(2)8-13)19-12-25-20(23-19)15-4-3-5-16(9-15)22-11-17(24)10-21/h3-9,12,17,22,24H,10-11H2,1-2H3.
What are the key properties of 1-chloro-3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]propan-2-ol?
1-chloro-3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]propan-2-ol has a molecular weight of 372.92 g/mol, XLogP of 5.11, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]propan-2-ol is sourced from PubChem (CID 168639561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).