C17H19ClN2O3 — CID 168639757
3-[4-[(3-chloro-2-hydroxypropyl)amino]phenoxy]-N-methylbenzamide (PubChem CID 168639757) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is 3-[4-[(3-chloro-2-hydroxypropyl)amino]phenoxy]-N-methylbenzamide.
| Compound Name | 3-[4-[(3-chloro-2-hydroxypropyl)amino]phenoxy]-N-methylbenzamide |
|---|---|
| PubChem CID | 168639757 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3-[4-[(3-chloro-2-hydroxypropyl)amino]phenoxy]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(Oc2ccc(NCC(O)CCl)cc2)c1 |
| InChI | InChI=1S/C17H19ClN2O3/c1-19-17(22)12-3-2-4-16(9-12)23-15-7-5-13(6-8-15)20-11-14(21)10-18/h2-9,14,20-21H,10-11H2,1H3,(H,19,22) |
| InChIKey | ZFZNDEKVMZZJBI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|