C18H16ClN5OS — CID 168640126
1-chloro-3-[3-(3-thiophen-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)anilino]propan-2-ol (PubChem CID 168640126) has the molecular formula C18H16ClN5OS and a molecular weight of 385.88 g/mol. Its IUPAC name is 1-chloro-3-[3-(3-thiophen-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)anilino]propan-2-ol.
| Compound Name | 1-chloro-3-[3-(3-thiophen-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 168640126 |
| Molecular Formula | C18H16ClN5OS |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 1-chloro-3-[3-(3-thiophen-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)anilino]propan-2-ol |
| SMILES | OC(CCl)CNc1cccc(-c2ccc3nnc(-c4cccs4)n3n2)c1 |
| InChI | InChI=1S/C18H16ClN5OS/c19-10-14(25)11-20-13-4-1-3-12(9-13)15-6-7-17-21-22-18(24(17)23-15)16-5-2-8-26-16/h1-9,14,20,25H,10-11H2 |
| InChIKey | CUJMISZHJRZJQN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|