C18H16ClNO3 — CID 168640682
1-[(3-chloro-2-hydroxypropyl)amino]-2-methylanthracene-9,10-dione (PubChem CID 168640682) has the molecular formula C18H16ClNO3 and a molecular weight of 329.78 g/mol. Its IUPAC name is 1-[(3-chloro-2-hydroxypropyl)amino]-2-methylanthracene-9,10-dione.
| Compound Name | 1-[(3-chloro-2-hydroxypropyl)amino]-2-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 168640682 |
| Molecular Formula | C18H16ClNO3 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1-[(3-chloro-2-hydroxypropyl)amino]-2-methylanthracene-9,10-dione |
| SMILES | Cc1ccc2c(c1NCC(O)CCl)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H16ClNO3/c1-10-6-7-14-15(16(10)20-9-11(21)8-19)18(23)13-5-3-2-4-12(13)17(14)22/h2-7,11,20-21H,8-9H2,1H3 |
| InChIKey | RVPQMTCLOIRTAG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|