C25H24N4O6 — CID 168642137
dimethyl 6-amino-5-cyano-1-[3-(ethoxycarbonylamino)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168642137) has the molecular formula C25H24N4O6 and a molecular weight of 476.49 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-[3-(ethoxycarbonylamino)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-[3-(ethoxycarbonylamino)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168642137 |
| Molecular Formula | C25H24N4O6 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-[3-(ethoxycarbonylamino)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | CCOC(=O)Nc1cccc(N2C(N)=C(C#N)C(c3ccccc3)C(C(=O)OC)=C2C(=O)OC)c1 |
| InChI | InChI=1S/C25H24N4O6/c1-4-35-25(32)28-16-11-8-12-17(13-16)29-21(24(31)34-3)20(23(30)33-2)19(18(14-26)22(29)27)15-9-6-5-7-10-15/h5-13,19H,4,27H2,1-3H3,(H,28,32) |
| InChIKey | PGJLOMHHTQIZGY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 143.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|