C31H28N4O7 — CID 168644608
dimethyl 6-amino-5-cyano-1-[2-(2-methoxyanilino)-5-methoxycarbonylphenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168644608) has the molecular formula C31H28N4O7 and a molecular weight of 568.59 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-[2-(2-methoxyanilino)-5-methoxycarbonylphenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-[2-(2-methoxyanilino)-5-methoxycarbonylphenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168644608 |
| Molecular Formula | C31H28N4O7 |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-[2-(2-methoxyanilino)-5-methoxycarbonylphenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(C(=O)OC)ccc2Nc2ccccc2OC)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C31H28N4O7/c1-39-24-13-9-8-12-22(24)34-21-15-14-19(29(36)40-2)16-23(21)35-27(31(38)42-4)26(30(37)41-3)25(20(17-32)28(35)33)18-10-6-5-7-11-18/h5-16,25,34H,33H2,1-4H3 |
| InChIKey | CZAQCXCYJBFOCA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 153.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|