About dimethyl 1-(6,7-dimethyl-3H-benzimidazol-5-yl)azepine-2,3-dicarboxylate
dimethyl 1-(6,7-dimethyl-3H-benzimidazol-5-yl)azepine-2,3-dicarboxylate (PubChem CID 168646515) has the molecular formula C19H19N3O4
and a molecular weight of 353.38 g/mol. Its IUPAC name is dimethyl 1-(6,7-dimethyl-3H-benzimidazol-5-yl)azepine-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 1-(6,7-dimethyl-3H-benzimidazol-5-yl)azepine-2,3-dicarboxylate |
| PubChem CID | 168646515 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | dimethyl 1-(6,7-dimethyl-3H-benzimidazol-5-yl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc3[nH]cnc3c(C)c2C)C=CC=C1 |
| InChI | InChI=1S/C19H19N3O4/c1-11-12(2)16-14(20-10-21-16)9-15(11)22-8-6-5-7-13(18(23)25-3)17(22)19(24)26-4/h5-10H,1-4H3,(H,20,21) |
| InChIKey | VMQPVNPKVMNGFF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dimethyl 1-(6,7-dimethyl-3H-benzimidazol-5-yl)azepine-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1-(6,7-dimethyl-3H-benzimidazol-5-yl)azepine-2,3-dicarboxylate?
The IUPAC name of dimethyl 1-(6,7-dimethyl-3H-benzimidazol-5-yl)azepine-2,3-dicarboxylate (CID 168646515) is dimethyl 1-(6,7-dimethyl-3H-benzimidazol-5-yl)azepine-2,3-dicarboxylate.
What is the SMILES notation for dimethyl 1-(6,7-dimethyl-3H-benzimidazol-5-yl)azepine-2,3-dicarboxylate?
The canonical SMILES for dimethyl 1-(6,7-dimethyl-3H-benzimidazol-5-yl)azepine-2,3-dicarboxylate is COC(=O)C1=C(C(=O)OC)N(c2cc3[nH]cnc3c(C)c2C)C=CC=C1.
What is the InChIKey of dimethyl 1-(6,7-dimethyl-3H-benzimidazol-5-yl)azepine-2,3-dicarboxylate?
The InChIKey is VMQPVNPKVMNGFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O4/c1-11-12(2)16-14(20-10-21-16)9-15(11)22-8-6-5-7-13(18(23)25-3)17(22)19(24)26-4/h5-10H,1-4H3,(H,20,21).
What are the key properties of dimethyl 1-(6,7-dimethyl-3H-benzimidazol-5-yl)azepine-2,3-dicarboxylate?
dimethyl 1-(6,7-dimethyl-3H-benzimidazol-5-yl)azepine-2,3-dicarboxylate has a molecular weight of 353.38 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1-(6,7-dimethyl-3H-benzimidazol-5-yl)azepine-2,3-dicarboxylate is sourced from PubChem (CID 168646515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).