About dimethyl 1-(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)azepine-2,3-dicarboxylate
dimethyl 1-(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)azepine-2,3-dicarboxylate (PubChem CID 168650032) has the molecular formula C22H24N2O5
and a molecular weight of 396.44 g/mol. Its IUPAC name is dimethyl 1-(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)azepine-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 1-(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)azepine-2,3-dicarboxylate |
| PubChem CID | 168650032 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | dimethyl 1-(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)azepine-2,3-dicarboxylate |
| SMILES | CCN1C(=O)C(C)(C)c2cc(N3C=CC=CC(C(=O)OC)=C3C(=O)OC)ccc21 |
| InChI | InChI=1S/C22H24N2O5/c1-6-23-17-11-10-14(13-16(17)22(2,3)21(23)27)24-12-8-7-9-15(19(25)28-4)18(24)20(26)29-5/h7-13H,6H2,1-5H3 |
| InChIKey | CHHAXGPUXMPVNX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dimethyl 1-(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)azepine-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1-(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)azepine-2,3-dicarboxylate?
The IUPAC name of dimethyl 1-(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)azepine-2,3-dicarboxylate (CID 168650032) is dimethyl 1-(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)azepine-2,3-dicarboxylate.
What is the SMILES notation for dimethyl 1-(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)azepine-2,3-dicarboxylate?
The canonical SMILES for dimethyl 1-(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)azepine-2,3-dicarboxylate is CCN1C(=O)C(C)(C)c2cc(N3C=CC=CC(C(=O)OC)=C3C(=O)OC)ccc21.
What is the InChIKey of dimethyl 1-(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)azepine-2,3-dicarboxylate?
The InChIKey is CHHAXGPUXMPVNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O5/c1-6-23-17-11-10-14(13-16(17)22(2,3)21(23)27)24-12-8-7-9-15(19(25)28-4)18(24)20(26)29-5/h7-13H,6H2,1-5H3.
What are the key properties of dimethyl 1-(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)azepine-2,3-dicarboxylate?
dimethyl 1-(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)azepine-2,3-dicarboxylate has a molecular weight of 396.44 g/mol, XLogP of 2.82, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1-(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)azepine-2,3-dicarboxylate is sourced from PubChem (CID 168650032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).