C22H19N3O8S — CID 168650036
dimethyl 1-[4-[(1-oxidopyridin-1-ium-3-carbonyl)sulfamoyl]phenyl]azepine-2,3-dicarboxylate (PubChem CID 168650036) has the molecular formula C22H19N3O8S and a molecular weight of 485.47 g/mol. Its IUPAC name is dimethyl 1-[4-[(1-oxidopyridin-1-ium-3-carbonyl)sulfamoyl]phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-[(1-oxidopyridin-1-ium-3-carbonyl)sulfamoyl]phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650036 |
| Molecular Formula | C22H19N3O8S |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | dimethyl 1-[4-[(1-oxidopyridin-1-ium-3-carbonyl)sulfamoyl]phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(S(=O)(=O)NC(=O)c3ccc[n+]([O-])c3)cc2)C=CC=C1 |
| InChI | InChI=1S/C22H19N3O8S/c1-32-21(27)18-7-3-4-13-25(19(18)22(28)33-2)16-8-10-17(11-9-16)34(30,31)23-20(26)15-6-5-12-24(29)14-15/h3-14H,1-2H3,(H,23,26) |
| InChIKey | NWQYGSOOBOBPMV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 146.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|