C15H10N2O4 — CID 168651629
N-[4-(1,3-dioxoisoindol-5-yl)oxyphenyl]formamide (PubChem CID 168651629) has the molecular formula C15H10N2O4 and a molecular weight of 282.25 g/mol. Its IUPAC name is N-[4-(1,3-dioxoisoindol-5-yl)oxyphenyl]formamide.
| Compound Name | N-[4-(1,3-dioxoisoindol-5-yl)oxyphenyl]formamide |
|---|---|
| PubChem CID | 168651629 |
| Molecular Formula | C15H10N2O4 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | N-[4-(1,3-dioxoisoindol-5-yl)oxyphenyl]formamide |
| SMILES | O=CNc1ccc(Oc2ccc3c(c2)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C15H10N2O4/c18-8-16-9-1-3-10(4-2-9)21-11-5-6-12-13(7-11)15(20)17-14(12)19/h1-8H,(H,16,18)(H,17,19,20) |
| InChIKey | KNKVGOXPYUQIAR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|