C14H17N5O — CID 168651654
N-[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]formamide (PubChem CID 168651654) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is N-[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]formamide.
| Compound Name | N-[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]formamide |
|---|---|
| PubChem CID | 168651654 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]formamide |
| SMILES | Cc1nc(Nc2ccc(NC=O)cc2)cc(N(C)C)n1 |
| InChI | InChI=1S/C14H17N5O/c1-10-16-13(8-14(17-10)19(2)3)18-12-6-4-11(5-7-12)15-9-20/h4-9H,1-3H3,(H,15,20)(H,16,17,18) |
| InChIKey | WZXBYUYOVDTGEL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|