About 3-fluoro-2-formamido-4,5-dimethoxybenzamide
3-fluoro-2-formamido-4,5-dimethoxybenzamide (PubChem CID 168652260) has the molecular formula C10H11FN2O4
and a molecular weight of 242.21 g/mol. Its IUPAC name is 3-fluoro-2-formamido-4,5-dimethoxybenzamide.
Molecular Properties
| Compound Name | 3-fluoro-2-formamido-4,5-dimethoxybenzamide |
| PubChem CID | 168652260 |
| Molecular Formula | C10H11FN2O4 |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 3-fluoro-2-formamido-4,5-dimethoxybenzamide |
| SMILES | COc1cc(C(N)=O)c(NC=O)c(F)c1OC |
| InChI | InChI=1S/C10H11FN2O4/c1-16-6-3-5(10(12)15)8(13-4-14)7(11)9(6)17-2/h3-4H,1-2H3,(H2,12,15)(H,13,14) |
| InChIKey | XTSGKLSLIQMLKK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-2-formamido-4,5-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2-formamido-4,5-dimethoxybenzamide?
The IUPAC name of 3-fluoro-2-formamido-4,5-dimethoxybenzamide (CID 168652260) is 3-fluoro-2-formamido-4,5-dimethoxybenzamide.
What is the SMILES notation for 3-fluoro-2-formamido-4,5-dimethoxybenzamide?
The canonical SMILES for 3-fluoro-2-formamido-4,5-dimethoxybenzamide is COc1cc(C(N)=O)c(NC=O)c(F)c1OC.
What is the InChIKey of 3-fluoro-2-formamido-4,5-dimethoxybenzamide?
The InChIKey is XTSGKLSLIQMLKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2O4/c1-16-6-3-5(10(12)15)8(13-4-14)7(11)9(6)17-2/h3-4H,1-2H3,(H2,12,15)(H,13,14).
What are the key properties of 3-fluoro-2-formamido-4,5-dimethoxybenzamide?
3-fluoro-2-formamido-4,5-dimethoxybenzamide has a molecular weight of 242.21 g/mol, XLogP of 0.51, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2-formamido-4,5-dimethoxybenzamide is sourced from PubChem (CID 168652260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).