C10H11FN2O4 — CID 168652260
3-fluoro-2-formamido-4,5-dimethoxybenzamide (PubChem CID 168652260) has the molecular formula C10H11FN2O4 and a molecular weight of 242.21 g/mol. Its IUPAC name is 3-fluoro-2-formamido-4,5-dimethoxybenzamide.
| Compound Name | 3-fluoro-2-formamido-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 168652260 |
| Molecular Formula | C10H11FN2O4 |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 3-fluoro-2-formamido-4,5-dimethoxybenzamide |
| SMILES | COc1cc(C(N)=O)c(NC=O)c(F)c1OC |
| InChI | InChI=1S/C10H11FN2O4/c1-16-6-3-5(10(12)15)8(13-4-14)7(11)9(6)17-2/h3-4H,1-2H3,(H2,12,15)(H,13,14) |
| InChIKey | XTSGKLSLIQMLKK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|