About N-(5-methyl-2,1,3-benzothiadiazol-4-yl)formamide
N-(5-methyl-2,1,3-benzothiadiazol-4-yl)formamide (PubChem CID 168653310) has the molecular formula C8H7N3OS
and a molecular weight of 193.23 g/mol. Its IUPAC name is N-(5-methyl-2,1,3-benzothiadiazol-4-yl)formamide.
Molecular Properties
| Compound Name | N-(5-methyl-2,1,3-benzothiadiazol-4-yl)formamide |
| PubChem CID | 168653310 |
| Molecular Formula | C8H7N3OS |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | N-(5-methyl-2,1,3-benzothiadiazol-4-yl)formamide |
| SMILES | Cc1ccc2nsnc2c1NC=O |
| InChI | InChI=1S/C8H7N3OS/c1-5-2-3-6-8(11-13-10-6)7(5)9-4-12/h2-4H,1H3,(H,9,12) |
| InChIKey | DDVOOLDQPDSMCU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(5-methyl-2,1,3-benzothiadiazol-4-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methyl-2,1,3-benzothiadiazol-4-yl)formamide?
The IUPAC name of N-(5-methyl-2,1,3-benzothiadiazol-4-yl)formamide (CID 168653310) is N-(5-methyl-2,1,3-benzothiadiazol-4-yl)formamide.
What is the SMILES notation for N-(5-methyl-2,1,3-benzothiadiazol-4-yl)formamide?
The canonical SMILES for N-(5-methyl-2,1,3-benzothiadiazol-4-yl)formamide is Cc1ccc2nsnc2c1NC=O.
What is the InChIKey of N-(5-methyl-2,1,3-benzothiadiazol-4-yl)formamide?
The InChIKey is DDVOOLDQPDSMCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3OS/c1-5-2-3-6-8(11-13-10-6)7(5)9-4-12/h2-4H,1H3,(H,9,12).
What are the key properties of N-(5-methyl-2,1,3-benzothiadiazol-4-yl)formamide?
N-(5-methyl-2,1,3-benzothiadiazol-4-yl)formamide has a molecular weight of 193.23 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methyl-2,1,3-benzothiadiazol-4-yl)formamide is sourced from PubChem (CID 168653310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).