About N-[2-bromo-3-(2,2-difluoroethoxy)phenyl]formamide
N-[2-bromo-3-(2,2-difluoroethoxy)phenyl]formamide (PubChem CID 168653329) has the molecular formula C9H8BrF2NO2
and a molecular weight of 280.07 g/mol. Its IUPAC name is N-[2-bromo-3-(2,2-difluoroethoxy)phenyl]formamide.
Molecular Properties
| Compound Name | N-[2-bromo-3-(2,2-difluoroethoxy)phenyl]formamide |
| PubChem CID | 168653329 |
| Molecular Formula | C9H8BrF2NO2 |
| Molecular Weight | 280.07 g/mol |
| Exact Mass | 278.97 |
| IUPAC Name | N-[2-bromo-3-(2,2-difluoroethoxy)phenyl]formamide |
| SMILES | O=CNc1cccc(OCC(F)F)c1Br |
| InChI | InChI=1S/C9H8BrF2NO2/c10-9-6(13-5-14)2-1-3-7(9)15-4-8(11)12/h1-3,5,8H,4H2,(H,13,14) |
| InChIKey | RVRMUQKPYUDYMK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.07 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[2-bromo-3-(2,2-difluoroethoxy)phenyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-bromo-3-(2,2-difluoroethoxy)phenyl]formamide?
The IUPAC name of N-[2-bromo-3-(2,2-difluoroethoxy)phenyl]formamide (CID 168653329) is N-[2-bromo-3-(2,2-difluoroethoxy)phenyl]formamide.
What is the SMILES notation for N-[2-bromo-3-(2,2-difluoroethoxy)phenyl]formamide?
The canonical SMILES for N-[2-bromo-3-(2,2-difluoroethoxy)phenyl]formamide is O=CNc1cccc(OCC(F)F)c1Br.
What is the InChIKey of N-[2-bromo-3-(2,2-difluoroethoxy)phenyl]formamide?
The InChIKey is RVRMUQKPYUDYMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrF2NO2/c10-9-6(13-5-14)2-1-3-7(9)15-4-8(11)12/h1-3,5,8H,4H2,(H,13,14).
What are the key properties of N-[2-bromo-3-(2,2-difluoroethoxy)phenyl]formamide?
N-[2-bromo-3-(2,2-difluoroethoxy)phenyl]formamide has a molecular weight of 280.07 g/mol, XLogP of 2.66, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-bromo-3-(2,2-difluoroethoxy)phenyl]formamide is sourced from PubChem (CID 168653329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).