About S-methyl 3,7-dimethyloct-6-enethioate
S-methyl 3,7-dimethyloct-6-enethioate (PubChem CID 168654774) has the molecular formula C11H20OS
and a molecular weight of 200.35 g/mol. Its IUPAC name is S-methyl 3,7-dimethyloct-6-enethioate.
Molecular Properties
| Compound Name | S-methyl 3,7-dimethyloct-6-enethioate |
| PubChem CID | 168654774 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | S-methyl 3,7-dimethyloct-6-enethioate |
| SMILES | CSC(=O)CC(C)CCC=C(C)C |
| InChI | InChI=1S/C11H20OS/c1-9(2)6-5-7-10(3)8-11(12)13-4/h6,10H,5,7-8H2,1-4H3 |
| InChIKey | GDHWWYRRANQWTN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl 3,7-dimethyloct-6-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl 3,7-dimethyloct-6-enethioate?
The IUPAC name of S-methyl 3,7-dimethyloct-6-enethioate (CID 168654774) is S-methyl 3,7-dimethyloct-6-enethioate.
What is the SMILES notation for S-methyl 3,7-dimethyloct-6-enethioate?
The canonical SMILES for S-methyl 3,7-dimethyloct-6-enethioate is CSC(=O)CC(C)CCC=C(C)C.
What is the InChIKey of S-methyl 3,7-dimethyloct-6-enethioate?
The InChIKey is GDHWWYRRANQWTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20OS/c1-9(2)6-5-7-10(3)8-11(12)13-4/h6,10H,5,7-8H2,1-4H3.
What are the key properties of S-methyl 3,7-dimethyloct-6-enethioate?
S-methyl 3,7-dimethyloct-6-enethioate has a molecular weight of 200.35 g/mol, XLogP of 3.65, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl 3,7-dimethyloct-6-enethioate is sourced from PubChem (CID 168654774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).