C20H20FN3O — CID 168655115
1-(2-fluorophenyl)-6-phenyl-2-(1,2,4-triazol-1-yl)hexan-1-one (PubChem CID 168655115) has the molecular formula C20H20FN3O and a molecular weight of 337.40 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-6-phenyl-2-(1,2,4-triazol-1-yl)hexan-1-one.
| Compound Name | 1-(2-fluorophenyl)-6-phenyl-2-(1,2,4-triazol-1-yl)hexan-1-one |
|---|---|
| PubChem CID | 168655115 |
| Molecular Formula | C20H20FN3O |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-(2-fluorophenyl)-6-phenyl-2-(1,2,4-triazol-1-yl)hexan-1-one |
| SMILES | O=C(c1ccccc1F)C(CCCCc1ccccc1)n1cncn1 |
| InChI | InChI=1S/C20H20FN3O/c21-18-12-6-5-11-17(18)20(25)19(24-15-22-14-23-24)13-7-4-10-16-8-2-1-3-9-16/h1-3,5-6,8-9,11-12,14-15,19H,4,7,10,13H2 |
| InChIKey | UMYNBXHOVNQDAQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|