C5H8 — CID 168655223
1,1,2-trideuterio-3-(dideuteriomethyl)buta-1,3-diene (PubChem CID 168655223) has the molecular formula C5H8 and a molecular weight of 73.15 g/mol. Its IUPAC name is 1,1,2-trideuterio-3-(dideuteriomethyl)buta-1,3-diene.
| Compound Name | 1,1,2-trideuterio-3-(dideuteriomethyl)buta-1,3-diene |
|---|---|
| PubChem CID | 168655223 |
| Molecular Formula | C5H8 |
| Molecular Weight | 73.15 g/mol |
| Exact Mass | 73.09 |
| IUPAC Name | 1,1,2-trideuterio-3-(dideuteriomethyl)buta-1,3-diene |
| SMILES | [2H]C([2H])=C([2H])C(=C)C([2H])[2H] |
| InChI | InChI=1S/C5H8/c1-4-5(2)3/h4H,1-2H2,3H3/i1D2,3D2,4D |
| InChIKey | RRHGJUQNOFWUDK-UZEBBDCZSA-N |
| XLogP | 1.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 73.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|