C13H23N5O — CID 168655418
1-[[(1S,3R)-3-(aminomethyl)cyclohexyl]methyl]-4-(azidomethyl)pyrrolidin-2-one (PubChem CID 168655418) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-[[(1S,3R)-3-(aminomethyl)cyclohexyl]methyl]-4-(azidomethyl)pyrrolidin-2-one.
| Compound Name | 1-[[(1S,3R)-3-(aminomethyl)cyclohexyl]methyl]-4-(azidomethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168655418 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 1-[[(1S,3R)-3-(aminomethyl)cyclohexyl]methyl]-4-(azidomethyl)pyrrolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(C[C@H]2CCC[C@@H](CN)C2)C1 |
| InChI | InChI=1S/C13H23N5O/c14-6-10-2-1-3-11(4-10)8-18-9-12(5-13(18)19)7-16-17-15/h10-12H,1-9,14H2/t10-,11+,12?/m1/s1 |
| InChIKey | FMMURJNWBFSUHG-UBNQGINQSA-N |
| XLogP | 1.91 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|