C13H15N5O3 — CID 168656611
4-(azidomethyl)-1-(2,4-dimethyl-5-nitrophenyl)pyrrolidin-2-one (PubChem CID 168656611) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is 4-(azidomethyl)-1-(2,4-dimethyl-5-nitrophenyl)pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-(2,4-dimethyl-5-nitrophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168656611 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 4-(azidomethyl)-1-(2,4-dimethyl-5-nitrophenyl)pyrrolidin-2-one |
| SMILES | Cc1cc(C)c([N+](=O)[O-])cc1N1CC(CN=[N+]=[N-])CC1=O |
| InChI | InChI=1S/C13H15N5O3/c1-8-3-9(2)12(18(20)21)5-11(8)17-7-10(4-13(17)19)6-15-16-14/h3,5,10H,4,6-7H2,1-2H3 |
| InChIKey | JCOUSROCBDODJS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 112.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|