C13H13F3N4O — CID 168656677
4-(azidomethyl)-1-[4-methyl-3-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 168656677) has the molecular formula C13H13F3N4O and a molecular weight of 298.27 g/mol. Its IUPAC name is 4-(azidomethyl)-1-[4-methyl-3-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-[4-methyl-3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168656677 |
| Molecular Formula | C13H13F3N4O |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 4-(azidomethyl)-1-[4-methyl-3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(N2CC(CN=[N+]=[N-])CC2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C13H13F3N4O/c1-8-2-3-10(5-11(8)13(14,15)16)20-7-9(4-12(20)21)6-18-19-17/h2-3,5,9H,4,6-7H2,1H3 |
| InChIKey | LJNHTOGFQKJQGQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 69.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|