C11H14N6O3 — CID 168657056
methyl 5-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-1-methylpyrazole-4-carboxylate (PubChem CID 168657056) has the molecular formula C11H14N6O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is methyl 5-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-1-methylpyrazole-4-carboxylate.
| Compound Name | methyl 5-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 168657056 |
| Molecular Formula | C11H14N6O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | methyl 5-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-1-methylpyrazole-4-carboxylate |
| SMILES | COC(=O)c1cnn(C)c1N1CC(CN=[N+]=[N-])CC1=O |
| InChI | InChI=1S/C11H14N6O3/c1-16-10(8(5-14-16)11(19)20-2)17-6-7(3-9(17)18)4-13-15-12/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | GVLNLORCAUKMJZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 113.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|