C9H10N6O2 — CID 168657080
2-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-1H-pyrimidin-6-one (PubChem CID 168657080) has the molecular formula C9H10N6O2 and a molecular weight of 234.22 g/mol. Its IUPAC name is 2-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 168657080 |
| Molecular Formula | C9H10N6O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-1H-pyrimidin-6-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(c2nccc(=O)[nH]2)C1 |
| InChI | InChI=1S/C9H10N6O2/c10-14-12-4-6-3-8(17)15(5-6)9-11-2-1-7(16)13-9/h1-2,6H,3-5H2,(H,11,13,16) |
| InChIKey | NBBFUTSXGWBWES-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|