About 4-(azidomethyl)-1-(1,3-oxazol-5-ylmethyl)pyrrolidin-2-one
4-(azidomethyl)-1-(1,3-oxazol-5-ylmethyl)pyrrolidin-2-one (PubChem CID 168657425) has the molecular formula C9H11N5O2
and a molecular weight of 221.22 g/mol. Its IUPAC name is 4-(azidomethyl)-1-(1,3-oxazol-5-ylmethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-(azidomethyl)-1-(1,3-oxazol-5-ylmethyl)pyrrolidin-2-one |
| PubChem CID | 168657425 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 4-(azidomethyl)-1-(1,3-oxazol-5-ylmethyl)pyrrolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(Cc2cnco2)C1 |
| InChI | InChI=1S/C9H11N5O2/c10-13-12-2-7-1-9(15)14(4-7)5-8-3-11-6-16-8/h3,6-7H,1-2,4-5H2 |
| InChIKey | LVUULBVCOLCNIQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 95.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(azidomethyl)-1-(1,3-oxazol-5-ylmethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azidomethyl)-1-(1,3-oxazol-5-ylmethyl)pyrrolidin-2-one?
The IUPAC name of 4-(azidomethyl)-1-(1,3-oxazol-5-ylmethyl)pyrrolidin-2-one (CID 168657425) is 4-(azidomethyl)-1-(1,3-oxazol-5-ylmethyl)pyrrolidin-2-one.
What is the SMILES notation for 4-(azidomethyl)-1-(1,3-oxazol-5-ylmethyl)pyrrolidin-2-one?
The canonical SMILES for 4-(azidomethyl)-1-(1,3-oxazol-5-ylmethyl)pyrrolidin-2-one is [N-]=[N+]=NCC1CC(=O)N(Cc2cnco2)C1.
What is the InChIKey of 4-(azidomethyl)-1-(1,3-oxazol-5-ylmethyl)pyrrolidin-2-one?
The InChIKey is LVUULBVCOLCNIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O2/c10-13-12-2-7-1-9(15)14(4-7)5-8-3-11-6-16-8/h3,6-7H,1-2,4-5H2.
What are the key properties of 4-(azidomethyl)-1-(1,3-oxazol-5-ylmethyl)pyrrolidin-2-one?
4-(azidomethyl)-1-(1,3-oxazol-5-ylmethyl)pyrrolidin-2-one has a molecular weight of 221.22 g/mol, XLogP of 1.33, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azidomethyl)-1-(1,3-oxazol-5-ylmethyl)pyrrolidin-2-one is sourced from PubChem (CID 168657425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).