C17H14N6O — CID 168658182
4-(azidomethyl)-1-(1,10-phenanthrolin-5-yl)pyrrolidin-2-one (PubChem CID 168658182) has the molecular formula C17H14N6O and a molecular weight of 318.34 g/mol. Its IUPAC name is 4-(azidomethyl)-1-(1,10-phenanthrolin-5-yl)pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-(1,10-phenanthrolin-5-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168658182 |
| Molecular Formula | C17H14N6O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-(azidomethyl)-1-(1,10-phenanthrolin-5-yl)pyrrolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(c2cc3cccnc3c3ncccc23)C1 |
| InChI | InChI=1S/C17H14N6O/c18-22-21-9-11-7-15(24)23(10-11)14-8-12-3-1-5-19-16(12)17-13(14)4-2-6-20-17/h1-6,8,11H,7,9-10H2 |
| InChIKey | CENMZGNAPQDYCC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|