C11H10ClN7O — CID 168658560
4-(azidomethyl)-1-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)pyrrolidin-2-one (PubChem CID 168658560) has the molecular formula C11H10ClN7O and a molecular weight of 291.70 g/mol. Its IUPAC name is 4-(azidomethyl)-1-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168658560 |
| Molecular Formula | C11H10ClN7O |
| Molecular Weight | 291.70 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 4-(azidomethyl)-1-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)pyrrolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(c2nc(Cl)c3cc[nH]c3n2)C1 |
| InChI | InChI=1S/C11H10ClN7O/c12-9-7-1-2-14-10(7)17-11(16-9)19-5-6(3-8(19)20)4-15-18-13/h1-2,6H,3-5H2,(H,14,16,17) |
| InChIKey | TUGKLHODAGKVOW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.70 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|