C13H15N3O5 — CID 168659478
methyl 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-3-nitrobenzoate (PubChem CID 168659478) has the molecular formula C13H15N3O5 and a molecular weight of 293.28 g/mol. Its IUPAC name is methyl 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-3-nitrobenzoate.
| Compound Name | methyl 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 168659478 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | methyl 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-3-nitrobenzoate |
| SMILES | COC(=O)c1ccc(N2CC(CN)CC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H15N3O5/c1-21-13(18)9-2-3-10(11(5-9)16(19)20)15-7-8(6-14)4-12(15)17/h2-3,5,8H,4,6-7,14H2,1H3 |
| InChIKey | NKZLSDQWRDNCNB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|